Introduction:Basic information about CAS 67846-62-2|N-[2-[(2-chloro-4,6-dinitrophenyl)azo]-5-(ethylamino)-4-(2-methoxyethoxy)phenyl]propi, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-[(2-chloro-4,6-dinitrophenyl)azo]-5-(ethylamino)-4-(2-methoxyethoxy)phenyl]propionamide |
|---|
| CAS Number | 67846-62-2 | Molecular Weight | 494.88600 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 723.5ºC at 760 mmHg |
|---|
| Molecular Formula | C20H23ClN6O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 391.4ºC |
|---|
Names
| Name | N-[2-[(2-chloro-4,6-dinitrophenyl)diazenyl]-5-(ethylamino)-4-(2-methoxyethoxy)phenyl]propanamide |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 723.5ºC at 760 mmHg |
|---|
| Molecular Formula | C20H23ClN6O7 |
|---|
| Molecular Weight | 494.88600 |
|---|
| Flash Point | 391.4ºC |
|---|
| Exact Mass | 494.13200 |
|---|
| PSA | 179.44000 |
|---|
| LogP | 7.14620 |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | TTXGBEVCKFDELR-UHFFFAOYSA-N |
|---|
| SMILES | CCNc1cc(NC(=O)CC)c(N=Nc2c(Cl)cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1OCCOC |
|---|