Introduction:Basic information about CAS 67874-70-8|N-[2-[(2,4-dinitrophenyl)azo]-5-[(2-hydroxy-3-phenoxypropyl)amino]-4-methoxyphenyl]ac, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-[(2,4-dinitrophenyl)azo]-5-[(2-hydroxy-3-phenoxypropyl)amino]-4-methoxyphenyl]acetamide |
|---|
| CAS Number | 67874-70-8 | Molecular Weight | 524.48300 |
|---|
| Density | 1.42g/cm3 | Boiling Point | 840.4ºC at 760 mmHg |
|---|
| Molecular Formula | C24H24N6O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 462ºC |
|---|
Names
| Name | N-[2-[(2,4-dinitrophenyl)diazenyl]-5-[(2-hydroxy-3-phenoxypropyl)amino]-4-methoxyphenyl]acetamide |
|---|
Chemical & Physical Properties
| Density | 1.42g/cm3 |
|---|
| Boiling Point | 840.4ºC at 760 mmHg |
|---|
| Molecular Formula | C24H24N6O8 |
|---|
| Molecular Weight | 524.48300 |
|---|
| Flash Point | 462ºC |
|---|
| Exact Mass | 524.16600 |
|---|
| PSA | 199.67000 |
|---|
| LogP | 6.50610 |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | MYRJIGORVBOITE-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(N=Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(NC(C)=O)cc1NCC(O)COc1ccccc1 |
|---|