Introduction：Basic information about CAS 866392-65-6|2-(Difluoromethyl)-4-methoxy-1H-benzimidazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(Difluoromethyl)-4-methoxy-1H-benzimidazole |
|---|
| CAS Number | 866392-65-6 | Molecular Weight | 198.169 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 349.6±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H8F2N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.2±27.9 °C |
|---|
Names
| Name | 2-(difluoromethyl)-4-methoxy-1H-benzimidazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 349.6±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H8F2N2O |
|---|
| Molecular Weight | 198.169 |
|---|
| Flash Point | 165.2±27.9 °C |
|---|
| Exact Mass | 198.060471 |
|---|
| PSA | 37.91000 |
|---|
| LogP | 1.84 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | UOCGIKDERISBDO-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc2[nH]c(C(F)F)nc12 |
|---|
Synonyms
| 2-difluoromethyl-4-methoxy-1H-benzimidazole |
| 2-(difluoromethyl)-4-methoxy-1H-benzo[d]imidazole |
| 1H-Benzimidazole, 2-(difluoromethyl)-4-methoxy- |
| 2-(Difluoromethyl)-4-methoxy-1H-benzimidazole |
| 2-Difluoromethyl-4-methoxybenzimidazole |
