Introduction：Basic information about CAS 548-27-6|calophyllolid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | calophyllolid |
|---|
| CAS Number | 548-27-6 | Molecular Weight | 416.46600 |
|---|
| Density | 1.213g/cm3 | Boiling Point | 661.2ºC at 760 mmHg |
|---|
| Molecular Formula | C26H24O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 224.4ºC |
|---|
Names
| Name | 5-methoxy-2,2-dimethyl-6-[(E)-2-methylbut-2-enoyl]-10-phenylpyrano[2,3-f]chromen-8-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.213g/cm3 |
|---|
| Boiling Point | 661.2ºC at 760 mmHg |
|---|
| Molecular Formula | C26H24O5 |
|---|
| Molecular Weight | 416.46600 |
|---|
| Flash Point | 224.4ºC |
|---|
| Exact Mass | 416.16200 |
|---|
| PSA | 65.74000 |
|---|
| LogP | 5.80170 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | PMBLOLOJQZPEND-GIDUJCDVSA-N |
|---|
| SMILES | CC=C(C)C(=O)c1c(OC)c2c(c3c(-c4ccccc4)cc(=O)oc13)OC(C)(C)C=C2 |
|---|
Synonyms
| 2H,8H-Benzo(1,2-b,3,4-b')dipyran-8-one,5-methoxy-2,2-dimethyl-6-(2-methylcrotonoyl)-10-phenyl-,(E) |
| Calophyllolide |
| Calophyllolid |
| 5-Methoxy-2,2-dimethyl-6-(2-methyl-1-oxo-2-butenyl)-10-phenyl-2H,8H-benzo(1,2-B':3,4-B')-dipyran-8-one |
| 5-methoxy-2,2-dimethyl-6-(2-methyl-trans-crotonoyl)-10-phenyl-2H-pyrano[2,3-f]chromen-8-one |
| 5-Methoxy-2,2-dimethyl-6-(2-methyl-trans-crotonoyl)-10-phenyl-2H-pyrano[2,3-f]chromen-8-on |
