Introduction:Basic information about CAS 57971-98-9|N,N'-[6,13-bis (acetylamino)-2,9-diethoxy-5a,6,12a,13-tetrahydro-3,10-triphennodi, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N'-[6,13-bis (acetylamino)-2,9-diethoxy-5a,6,12a,13-tetrahydro-3,10-triphennodioxazinediyl]bis-Benazmide |
|---|
| CAS Number | 57971-98-9 | Molecular Weight | 730.76500 |
|---|
| Density | 1.41 g/cm3 | Boiling Point | 873.6ºC at 760 mmHg |
|---|
| Molecular Formula | C40H38N6O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 482.1ºC |
|---|
Names
| Name | N-(6,13-diacetamido-3-benzamido-2,9-diethoxy-5a,6,12a,13-tetrahydro-[1,4]benzoxazino[2,3-b]phenoxazin-10-yl)benzamide |
|---|
Chemical & Physical Properties
| Density | 1.41 g/cm3 |
|---|
| Boiling Point | 873.6ºC at 760 mmHg |
|---|
| Molecular Formula | C40H38N6O8 |
|---|
| Molecular Weight | 730.76500 |
|---|
| Flash Point | 482.1ºC |
|---|
| Exact Mass | 730.27500 |
|---|
| PSA | 192.00000 |
|---|
| LogP | 6.69860 |
|---|
| Index of Refraction | 1.684 |
|---|
| InChIKey | SPJYXNHHZOGJIX-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc2c(cc1NC(=O)c1ccccc1)OC1C(=N2)C(NC(C)=O)C2Oc3cc(NC(=O)c4ccccc4)c(OCC)cc3N=C2C1NC(C)=O |
|---|