Introduction:Basic information about CAS 151222-50-3|Terbinafine Impurity 5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Terbinafine Impurity 5 |
|---|
| CAS Number | 151222-50-3 | Molecular Weight | 305.457 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 432.8±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H27N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.9±22.3 °C |
|---|
Names
| Name | (E)-N,6,6-trimethyl-N-[(4-methylnaphthalen-1-yl)methyl]hept-2-en-4-yn-1-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 432.8±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H27N |
|---|
| Molecular Weight | 305.457 |
|---|
| Flash Point | 190.9±22.3 °C |
|---|
| Exact Mass | 305.214355 |
|---|
| PSA | 3.24000 |
|---|
| LogP | 7.07 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | DRWRMSGOBQMKBI-UXBLZVDNSA-N |
|---|
| SMILES | Cc1ccc(CN(C)CC=CC#CC(C)(C)C)c2ccccc12 |
|---|
Synonyms
| 4-Methylterbinafine |
| Terbinafine hydrochloride impurity D [EP] |
| (2E)-N,6,6-Trimethyl-N-[(4-methyl-1-naphthyl)methyl]-2-hepten-4-yn-1-amine |
| 1-Naphthalenemethanamine,N-((2E)-6,6-dimethyl-2-hepten-4-ynyl)-N,4-dimethyl |
| (2E)-N,6,6-Trimethyl-N-((4-methylnaphthalen-1-yl)methyl)hept-2-en-4-yn-1-amine |
| UNII-3JMB1FFJ85 |
| (2E)-N,6,6-trimethyl-N-[(4-methylnaphthalen-1-yl)methyl]hept-2-en-4-yn-1-amine |
| 1-Naphthalenemethanamine, N-[(2E)-6,6-dimethyl-2-hepten-4-yn-1-yl]-N,4-dimethyl- |
| Terbinafine hydrochloride impurity,4-methylterbinafine-[USP] |
| Terbinafine related compound D free base |
| Terbinafine Impurity 5 |