Introduction：Basic information about CAS 871108-05-3|trabodenoson, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | trabodenoson |
|---|
| CAS Number | 871108-05-3 | Molecular Weight | 380.356 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 691.2±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H20N6O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 371.8±34.3 °C |
|---|
Names
| Name | [(2R,3S,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl nitrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 691.2±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H20N6O6 |
|---|
| Molecular Weight | 380.356 |
|---|
| Flash Point | 371.8±34.3 °C |
|---|
| Exact Mass | 380.144440 |
|---|
| PSA | 160.37000 |
|---|
| LogP | 2.61 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.816 |
|---|
| InChIKey | AQLVRTWKJDTWQQ-SDBHATRESA-N |
|---|
| SMILES | O=[N+]([O-])OCC1OC(n2cnc3c(NC4CCCC4)ncnc32)C(O)C1O |
|---|
Synonyms
| Adenosine, N-cyclopentyl-, 5'-nitrate |
| Trabodenoson |
| PJ 875 |
| N-Cyclopentyladenosine 5'-nitrate |
| UNII-1T237110W4 |
| INNO-8875 |
| N-Cyclopentyl-5'-O-nitroadenosine |
| N6-Cyclopentyladenosine 5'-nitrate |
