Introduction：Basic information about CAS 1124-31-8|Potassium ρ-nitrophenolate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Potassium ρ-nitrophenolate |
|---|
| CAS Number | 1124-31-8 | Molecular Weight | 177.19900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C6H4KNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Potassium ρ-nitrophenolate |
|---|
Chemical & Physical Properties
| Molecular Formula | C6H4KNO3 |
|---|
| Molecular Weight | 177.19900 |
|---|
| Exact Mass | 176.98300 |
|---|
| PSA | 68.88000 |
|---|
| LogP | 2.26180 |
|---|
| InChIKey | VMZBTPALYWVSGZ-UHFFFAOYSA-M |
|---|
| SMILES | O=[N+]([O-])c1ccccc1[O-].[K+] |
|---|
Safety Information
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
