Introduction:Basic information about CAS 115871-18-6|da-67, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | da-67 |
|---|
| CAS Number | 115871-18-6 | Molecular Weight | 408.45000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H21N4NaO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | sodium salt of 10-(carboxymethylaminocarbonyl)-3,7-bis(dimethylamino)phenothiazine |
|---|
Chemical & Physical Properties
| Molecular Formula | C19H21N4NaO3S |
|---|
| Molecular Weight | 408.45000 |
|---|
| Exact Mass | 408.12300 |
|---|
| PSA | 104.25000 |
|---|
| LogP | 2.33670 |
|---|
| InChIKey | CWLYDTVACYGEPD-UHFFFAOYSA-M |
|---|
| SMILES | CN(C)c1ccc2c(c1)Sc1cc(N(C)C)ccc1N2C(=O)NCC(=O)[O-].[Na+] |
|---|