Introduction:Basic information about CAS 35399-32-7|3-(beta-D-Galactopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-6,7-dimethoxy-4H-1-benzo, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(beta-D-Galactopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one |
|---|
| CAS Number | 35399-32-7 | Molecular Weight | 492.42900 |
|---|
| Density | 1.65 | Boiling Point | / |
|---|
| Molecular Formula | C23H24O12 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | Eupalitin-3-galactosid |
|---|
Chemical & Physical Properties
| Density | 1.65 |
|---|
| Molecular Formula | C23H24O12 |
|---|
| Molecular Weight | 492.42900 |
|---|
| Exact Mass | 492.12700 |
|---|
| PSA | 188.51000 |
|---|
| LogP | 0.06710 |
|---|
| InChIKey | FFRYQAOUWMJQCX-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2oc(-c3ccc(O)cc3)c(OC3OC(CO)C(O)C(O)C3O)c(=O)c2c(O)c1OC |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|