Introduction：Basic information about CAS 19357-22-3|2-(3-Bromophenyl)-1H-isoindole-1,3(2H)-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3-Bromophenyl)-1H-isoindole-1,3(2H)-dione |
|---|
| CAS Number | 19357-22-3 | Molecular Weight | 302.123 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 449.3±47.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H8BrNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 225.6±29.3 °C |
|---|
Names
| Name | N-(3-bromophenyl)phthalimide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 449.3±47.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H8BrNO2 |
|---|
| Molecular Weight | 302.123 |
|---|
| Flash Point | 225.6±29.3 °C |
|---|
| Exact Mass | 300.973846 |
|---|
| PSA | 37.38000 |
|---|
| LogP | 3.17 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.688 |
|---|
| InChIKey | SMVJGKRXJINAFW-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(Br)c1 |
|---|
Synonyms
| 2-(3-bromobenzyl)isoindoline-1,3-dione |
| 1H-Isoindole-1,3(2H)-dione, 2-(3-bromophenyl)- |
| N-(3-bromo-phenyl)-phthalimide |
| N-m-Bromphenylphthalimid |
| 2-(3-Bromophenyl)-1H-isoindole-1,3(2H)-dione |
