Introduction：Basic information about CAS 59756-57-9|1-phenyl-3-(3-(trifluoromethyl)phenyl)acetone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-phenyl-3-(3-(trifluoromethyl)phenyl)acetone |
|---|
| CAS Number | 59756-57-9 | Molecular Weight | 278.269 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 326.0±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H13F3O | Melting Point | 140-145ºC (4mmHg) |
|---|
| MSDS | / | Flash Point | 179.9±18.0 °C |
|---|
Names
| Name | 1-phenyl-3-[3-(trifluoromethyl)phenyl]propan-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 326.0±37.0 °C at 760 mmHg |
|---|
| Melting Point | 140-145ºC (4mmHg) |
|---|
| Molecular Formula | C16H13F3O |
|---|
| Molecular Weight | 278.269 |
|---|
| Flash Point | 179.9±18.0 °C |
|---|
| Exact Mass | 278.091858 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.56 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.520 |
|---|
| InChIKey | MHBVFQPMQKODRK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cc1ccccc1)Cc1cccc(C(F)(F)F)c1 |
|---|
Synonyms
| 1-Phenyl-3-[3-(trifluoromethyl)phenyl]acetone |
| einecs 261-915-0 |
| 2-Propanone, 1-phenyl-3-[3-(trifluoromethyl)phenyl]- |
| 1-phenyl-3-(3-(trifluoromethyl)phenyl)acetone |
| 1-Phenyl-3-(α,α,α-trifluoro-m-tolyl)-2-propanone |
| 2-Propanone, 1-phenyl-3-(3-(trifluoromethyl)phenyl)- |
