Introduction：Basic information about CAS 118-57-0|acetaminosalol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | acetaminosalol |
|---|
| CAS Number | 118-57-0 | Molecular Weight | 271.26800 |
|---|
| Density | 1.327g/cm3 | Boiling Point | 476.3ºC at 760mmHg |
|---|
| Molecular Formula | C15H13NO4 | Melting Point | 187° |
|---|
| MSDS | / | Flash Point | 241.9ºC |
|---|
Names
| Name | (4-acetamidophenyl) 2-hydroxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.327g/cm3 |
|---|
| Boiling Point | 476.3ºC at 760mmHg |
|---|
| Melting Point | 187° |
|---|
| Molecular Formula | C15H13NO4 |
|---|
| Molecular Weight | 271.26800 |
|---|
| Flash Point | 241.9ºC |
|---|
| Exact Mass | 271.08400 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 2.64280 |
|---|
| Vapour Pressure | 1.07E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | TWIIVLKQFJBFPW-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(OC(=O)c2ccccc2O)cc1 |
|---|
| Stability | Stable. Incompatible with strong oxidizing agents. |
|---|
Synonyms
| 4-acetamidophenyl 2-hydroxybenzoate |
| EINECS 204-261-3 |
| Acetaminosalolum |
| Phenetsal |
| 4-Acetamino-1-salicyloyloxy-benzol |
| Acetaminosalolo |
| acetaminosalol |
| 1-acetylamino-4-salicyloyloxy-benzene |
| Salophen |
| 1-Acetylamino-4-salicyloyloxy-benzol |
