Introduction：Basic information about CAS 67905-17-3|Solvent Blue 122, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Solvent Blue 122 |
|---|
| CAS Number | 67905-17-3 | Molecular Weight | 372.373 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 631.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H16N2O4 | Melting Point | 210ºC |
|---|
| MSDS | / | Flash Point | 335.7±31.5 °C |
|---|
Names
| Name | Solvent Blue 122 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 631.4±55.0 °C at 760 mmHg |
|---|
| Melting Point | 210ºC |
|---|
| Molecular Formula | C22H16N2O4 |
|---|
| Molecular Weight | 372.373 |
|---|
| Flash Point | 335.7±31.5 °C |
|---|
| Exact Mass | 372.110992 |
|---|
| PSA | 95.50000 |
|---|
| LogP | 3.78 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.747 |
|---|
| InChIKey | DAPGHBPTUCXSRG-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(Nc2ccc(O)c3c2C(=O)c2ccccc2C3=O)cc1 |
|---|
Synonyms
| Transparent Blue 2RA |
| polysynthren blue r |
| N-{4-[(4-Hydroxy-9,10-dioxo-9,10-dihydroanthracen-1-yl)amino]phenyl}acetamide |
| Filester Blue 2RA |
| Acetamide, N-[4-[(9,10-dihydro-4-hydroxy-9,10-dioxo-1-anthracenyl)amino]phenyl]- |
| MFCD08458446 |
| Rosaplast Blue R. |
| N-{4-[(4-Hydroxy-9,10-dioxo-9,10-dihydro-1-anthracenyl)amino]phenyl}acetamide |
| EINECS 267-636-0 |
| Transparent Blue R |
| Polysynthren Blue G |
