Introduction:Basic information about CAS 401788-98-5|1-butyl-3-methylimidazolium methylsulfate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-butyl-3-methylimidazolium methylsulfate |
|---|
| CAS Number | 401788-98-5 | Molecular Weight | 250.31500 |
|---|
| Density | 1.21 | Boiling Point | / |
|---|
| Molecular Formula | C9H18N2O4S | Melting Point | -4°C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | 1-butyl-3-methylimidazol-3-ium,methyl sulfate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.21 |
|---|
| Melting Point | -4°C(lit.) |
|---|
| Molecular Formula | C9H18N2O4S |
|---|
| Molecular Weight | 250.31500 |
|---|
| Exact Mass | 250.09900 |
|---|
| PSA | 83.62000 |
|---|
| LogP | 1.28650 |
|---|
| Appearance of Characters | liquid | yellow |
|---|
| Index of Refraction | n20/D 1.478 |
|---|
| InChIKey | MEMNKNZDROKJHP-UHFFFAOYSA-M |
|---|
| SMILES | CCCCn1cc[n+](C)c1.COS(=O)(=O)[O-] |
|---|
| Stability | hygroscopic |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | C |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36-45 |
|---|
| RIDADR | UN 3265 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| HS Code | 2933290090 |
|---|
Customs
| HS Code | 2933290090 |
|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| MFCD03095437 |
| 1-butyl-3-methyl-3H-imidazolium methyl sulfate |
| [Emim][MeSO4] |
| [BMIM][MeSO4] |
| [C4C1im][MeSO4] |
| Basionics(R) LQ02 |
| 1-Butyl-3-methylimidazolium methyl sulfate |
| [BMIM][MeOSO3] |
| 1-n-Butyl-3-methylimidazolium methyl sulfate |