Introduction：Basic information about CAS 151978-66-4|tert-butyl 4-(4-iodophenyl)tetrahydro-1(2h)-pyrazinecarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl 4-(4-iodophenyl)tetrahydro-1(2h)-pyrazinecarboxylate |
|---|
| CAS Number | 151978-66-4 | Molecular Weight | 388.244 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 439.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H21IN2O2 | Melting Point | 150ºC |
|---|
| MSDS | / | Flash Point | 219.6±27.3 °C |
|---|
Names
| Name | tert-Butyl 4-(4-iodophenyl)piperazine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 439.5±40.0 °C at 760 mmHg |
|---|
| Melting Point | 150ºC |
|---|
| Molecular Formula | C15H21IN2O2 |
|---|
| Molecular Weight | 388.244 |
|---|
| Flash Point | 219.6±27.3 °C |
|---|
| Exact Mass | 388.064758 |
|---|
| PSA | 32.78000 |
|---|
| LogP | 3.66 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | ZOWJTZMYSLZILG-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(I)cc2)CC1 |
|---|
Synonyms
| 2-Methyl-2-propanyl 4-(4-iodophenyl)-1-piperazinecarboxylate |
| 4-(4-iodophenyl)-piperazine-1-carboxylic acid tert-butyl ester |
| tert-butyl 4-(4-iodophenyl)tetrahydro-1(2H)-pyrazinecarboxylate |
| 4-(4-Iodophenyl)piperazine,N1-BOC protected |
| t-butyl 4-(4-iodophenyl)piperazine-1-carboxylate |
| 1-Piperazinecarboxylicacid,4-(4-iodophenyl)-,1,1-dimethylethyl ester |
| 1-Piperazinecarboxylic acid, 4-(4-iodophenyl)-, 1,1-dimethylethyl ester |
