Introduction：Basic information about CAS 204760-82-7|3-cyanopropylphenyldimethoxysilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-cyanopropylphenyldimethoxysilane |
|---|
| CAS Number | 204760-82-7 | Molecular Weight | 235.35400 |
|---|
| Density | 1.103 g/cm3 | Boiling Point | 138ºC 1mm |
|---|
| Molecular Formula | C12H17NO2Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 146.1ºC |
|---|
Names
| Name | 4-[dimethoxy(phenyl)silyl]butanenitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.103 g/cm3 |
|---|
| Boiling Point | 138ºC 1mm |
|---|
| Molecular Formula | C12H17NO2Si |
|---|
| Molecular Weight | 235.35400 |
|---|
| Flash Point | 146.1ºC |
|---|
| Exact Mass | 235.10300 |
|---|
| PSA | 42.25000 |
|---|
| LogP | 1.93238 |
|---|
| Vapour Pressure | 0.000371mmHg at 25°C |
|---|
| Index of Refraction | 1.497 |
|---|
| InChIKey | DYLNEUKFYBCJNO-UHFFFAOYSA-N |
|---|
| SMILES | CO[Si](CCCC#N)(OC)c1ccccc1 |
|---|
Synonyms
| 3-Cyanopropylphenyldimethoxysilane |
| Butanenitrile,4-(dimethoxyphenylsilyl) |
