Introduction：Basic information about CAS 70411-42-6|4-(Trimethoxysilyl)aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Trimethoxysilyl)aniline |
|---|
| CAS Number | 70411-42-6 | Molecular Weight | 213.306 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 241.2±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H15NO3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 99.7±22.6 °C |
|---|
Names
| Name | 3-trimethoxysilylaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 241.2±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H15NO3Si |
|---|
| Molecular Weight | 213.306 |
|---|
| Flash Point | 99.7±22.6 °C |
|---|
| Exact Mass | 213.082123 |
|---|
| PSA | 53.71000 |
|---|
| LogP | 0.11 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.502 |
|---|
| InChIKey | YMTRNELCZAZKRB-UHFFFAOYSA-N |
|---|
| SMILES | CO[Si](OC)(OC)c1cccc(N)c1 |
|---|
Synonyms
| Benzenamine, 4-(trimethoxysilyl)- |
| aminophenyltrimethoxysilane |
| Benzenamine,4-(trimethoxysilyl) |
| 3-aminophenyltrimethoxysilane |
| m-aminophenyl trimethoxysilane |
| 4-(Trimethoxysilyl)aniline |
| p-Aminophenyltrimethoxysilane |
