Introduction：Basic information about CAS 57729-79-0|4-amino-3-chloro-5-nitrobenzotrifluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-amino-3-chloro-5-nitrobenzotrifluoride |
|---|
| CAS Number | 57729-79-0 | Molecular Weight | 240.56700 |
|---|
| Density | 1.614g/cm3 | Boiling Point | 257.6ºC at 760mmHg |
|---|
| Molecular Formula | C7H4ClF3N2O2 | Melting Point | 65-69 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 109.6ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-chloro-6-nitro-4-(trifluoromethyl)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.614g/cm3 |
|---|
| Boiling Point | 257.6ºC at 760mmHg |
|---|
| Melting Point | 65-69 °C |
|---|
| Molecular Formula | C7H4ClF3N2O2 |
|---|
| Molecular Weight | 240.56700 |
|---|
| Flash Point | 109.6ºC |
|---|
| Exact Mass | 239.99100 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 3.95360 |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | JLWRJMVXRUKFPA-UHFFFAOYSA-N |
|---|
| SMILES | Nc1c(Cl)cc(C(F)(F)F)cc1[N+](=O)[O-] |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi,Xn |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36-S36/37/39 |
|---|
| RIDADR | 3276 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2921420090 |
|---|
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 6-chloro-2-nitro-4-(trifluoromethyl)phenylamine |
| MFCD00042153 |
| 2-chloro-6-nitro-4-trifluoromethylaniline |
| 4-Amino-3-chloro-5-nitrobenzotrifluoride |
