Introduction：Basic information about CAS 151858-64-9|5-(2-pyridyl)thiophene-2-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(2-pyridyl)thiophene-2-sulfonyl chloride |
|---|
| CAS Number | 151858-64-9 | Molecular Weight | 259.73200 |
|---|
| Density | 1.492g/cm3 | Boiling Point | 412.5ºC at 760mmHg |
|---|
| Molecular Formula | C9H6ClNO2S2 | Melting Point | 87-90ºC |
|---|
| MSDS | / | Flash Point | 203.3ºC |
|---|
Names
| Name | 5-pyridin-2-ylthiophene-2-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.492g/cm3 |
|---|
| Boiling Point | 412.5ºC at 760mmHg |
|---|
| Melting Point | 87-90ºC |
|---|
| Molecular Formula | C9H6ClNO2S2 |
|---|
| Molecular Weight | 259.73200 |
|---|
| Flash Point | 203.3ºC |
|---|
| Exact Mass | 258.95300 |
|---|
| PSA | 83.65000 |
|---|
| LogP | 3.81840 |
|---|
| Vapour Pressure | 1.23E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | OGOMWPWAEIDEOU-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc(-c2ccccn2)s1 |
|---|
Safety Information
| Hazard Codes | Xi,C |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3261 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-(pyridin-2-yl)thiophen-2-yl-sulfonyl chloride |
| 2-Thiophenesulfonylchloride,5-(2-pyridinyl) |
| 5-(pyrid-2-yl)thiophene-2-sulfonyl chloride |
| MFCD00052284 |
| 5-(2-pyridinyl)thiophene-2-sulfonyl chloride |
| 5-(pyridin-2-yl)-thiophene-2-sulfonyl chloride |
| 5-(2-pyridyl)thiophene-2-sulfonylchloride |
