Introduction:Basic information about CAS 73357-18-3|4,5-dimethoxy-2-nitrophenylacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,5-dimethoxy-2-nitrophenylacetic acid |
|---|
| CAS Number | 73357-18-3 | Molecular Weight | 241.19700 |
|---|
| Density | / | Boiling Point | 433.4ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11NO6 | Melting Point | 206-208°C |
|---|
| MSDS | / | Flash Point | 215.9ºC |
|---|
Names
| Name | 2-(4,5-dimethoxy-2-nitrophenyl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 433.4ºC at 760 mmHg |
|---|
| Melting Point | 206-208°C |
|---|
| Molecular Formula | C10H11NO6 |
|---|
| Molecular Weight | 241.19700 |
|---|
| Flash Point | 215.9ºC |
|---|
| Exact Mass | 241.05900 |
|---|
| PSA | 101.58000 |
|---|
| LogP | 1.76230 |
|---|
| InChIKey | WJPMJFUEMVXUCV-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(CC(=O)O)c([N+](=O)[O-])cc1OC |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (4,5-dimethoxy-2-nitrophenyl)acetic acid |
| 3,4-dimethoxy-6-nitrophenylacetic acid |
| 2-nitro-4,5-dimethoxyphenylacetic acid |
| (4,5-dimethoxy-2-nitrophenyl)ethanoic acid |
| MFCD00118466 |
| 2-(2-BROMOPHENOXY)ETHYL]DIMETHYLAMINE OXALATE |