Introduction:Basic information about CAS 87836-73-5|5-(9H-XANTHEN-9-YL)-1,3,4-OXADIAZOL-2-OL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(9H-XANTHEN-9-YL)-1,3,4-OXADIAZOL-2-OL |
|---|
| CAS Number | 87836-73-5 | Molecular Weight | 266.25200 |
|---|
| Density | 1.48g/cm3 | Boiling Point | 468ºC at 760 mmHg |
|---|
| Molecular Formula | C15H10N2O3 | Melting Point | 335ºC |
|---|
| MSDS | / | Flash Point | 236.8ºC |
|---|
Names
| Name | 5-(9H-xanthen-9-yl)-3H-1,3,4-oxadiazol-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.48g/cm3 |
|---|
| Boiling Point | 468ºC at 760 mmHg |
|---|
| Melting Point | 335ºC |
|---|
| Molecular Formula | C15H10N2O3 |
|---|
| Molecular Weight | 266.25200 |
|---|
| Flash Point | 236.8ºC |
|---|
| Exact Mass | 266.06900 |
|---|
| PSA | 68.38000 |
|---|
| LogP | 3.06110 |
|---|
| Index of Refraction | 1.723 |
|---|
| InChIKey | FCKSJNBVCBGASY-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]nc(C2c3ccccc3Oc3ccccc32)o1 |
|---|
Synonyms
| HMS559M04 |
| 5-xanthen-9-yl-1,3,4-oxadiazol-2-ol |
| 5-(9H-xanthen-9-yl)-1,3,4-oxadiazol-2-ol |