Introduction：Basic information about CAS 99532-51-1|1-(benzenesulfonyl)indole-3-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(benzenesulfonyl)indole-3-carbonyl chloride |
|---|
| CAS Number | 99532-51-1 | Molecular Weight | 319.76300 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 515.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H10ClNO3S | Melting Point | 144ºC |
|---|
| MSDS | / | Flash Point | 265.6ºC |
|---|
Names
| Name | 1-(benzenesulfonyl)indole-3-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 515.6ºC at 760 mmHg |
|---|
| Melting Point | 144ºC |
|---|
| Molecular Formula | C15H10ClNO3S |
|---|
| Molecular Weight | 319.76300 |
|---|
| Flash Point | 265.6ºC |
|---|
| Exact Mass | 319.00700 |
|---|
| PSA | 64.52000 |
|---|
| LogP | 4.33810 |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | RDVIVYUKRJAERC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cn(S(=O)(=O)c2ccccc2)c2ccccc12 |
|---|
Safety Information
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-(chlorocarbonyl)-1-(phenylsulfonyl)-1H-indole |
| 1-(phenylsulfonyl)-1H-indole-3-carbonyl chloride |
| 1-(Phenylsulphonyl)-1H-indole-3-carbonyl chloride |
| 1-phenylsulfonylindol-3-ylcarboxylic acid chloride |
| 3-chlorocarbonyl-1-phenylsulfonylindole |
