Introduction：Basic information about CAS 845266-29-7|5-OCT-1-YNYLNICOTINIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-OCT-1-YNYLNICOTINIC ACID |
|---|
| CAS Number | 845266-29-7 | Molecular Weight | 231.29000 |
|---|
| Density | 1.11g/cm3 | Boiling Point | 409ºC at 760 mmHg |
|---|
| Molecular Formula | C14H17NO2 | Melting Point | 120ºC |
|---|
| MSDS | / | Flash Point | 201.2ºC |
|---|
Names
| Name | 5-oct-1-ynylpyridine-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.11g/cm3 |
|---|
| Boiling Point | 409ºC at 760 mmHg |
|---|
| Melting Point | 120ºC |
|---|
| Molecular Formula | C14H17NO2 |
|---|
| Molecular Weight | 231.29000 |
|---|
| Flash Point | 201.2ºC |
|---|
| Exact Mass | 231.12600 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 3.10170 |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | QCJIZXKMWCHTFZ-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCC#Cc1cncc(C(=O)O)c1 |
|---|
Synonyms
| HMS555H16 |
| 5-oct-1-ynylnicotinic acid |
