Introduction：Basic information about CAS 90273-30-6|5-methyl-1-benzothiophene-2-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-methyl-1-benzothiophene-2-sulfonyl chloride |
|---|
| CAS Number | 90273-30-6 | Molecular Weight | 246.73400 |
|---|
| Density | 1.486g/cm3 | Boiling Point | 382.6ºC at 760mmHg |
|---|
| Molecular Formula | C9H7ClO2S2 | Melting Point | 83-84ºC |
|---|
| MSDS | / | Flash Point | 185.2ºC |
|---|
Names
| Name | 5-methyl-1-benzothiophene-2-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.486g/cm3 |
|---|
| Boiling Point | 382.6ºC at 760mmHg |
|---|
| Melting Point | 83-84ºC |
|---|
| Molecular Formula | C9H7ClO2S2 |
|---|
| Molecular Weight | 246.73400 |
|---|
| Flash Point | 185.2ºC |
|---|
| Exact Mass | 245.95800 |
|---|
| PSA | 70.76000 |
|---|
| LogP | 4.21800 |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | YGGJYXHTCDQVDB-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc2sc(S(=O)(=O)Cl)cc2c1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
Synonyms
| 5-methyl-benzo[b]thiophenesulfonyl chloride |
| 5-Methyl-thionaphthensulfonsaeure-(2)-chlorid |
| 5-Methylbenzo[b]thiophene2-sulfonyl chloride |
