Introduction：Basic information about CAS 844891-16-3|3-[5-(2,4-DIFLUOROPHENYL)-2-FURYL]ACRYLIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[5-(2,4-DIFLUOROPHENYL)-2-FURYL]ACRYLIC ACID |
|---|
| CAS Number | 844891-16-3 | Molecular Weight | 250.19800 |
|---|
| Density | 1.378g/cm3 | Boiling Point | 374.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8F2O3 | Melting Point | 218ºC |
|---|
| MSDS | / | Flash Point | 180.1ºC |
|---|
Names
| Name | 3-[5-(2,4-difluorophenyl)furan-2-yl]prop-2-enoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.378g/cm3 |
|---|
| Boiling Point | 374.2ºC at 760 mmHg |
|---|
| Melting Point | 218ºC |
|---|
| Molecular Formula | C13H8F2O3 |
|---|
| Molecular Weight | 250.19800 |
|---|
| Flash Point | 180.1ºC |
|---|
| Exact Mass | 250.04400 |
|---|
| PSA | 50.44000 |
|---|
| LogP | 3.32260 |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | PUFRUEMJSQVGSX-ZZXKWVIFSA-N |
|---|
| SMILES | O=C(O)C=Cc1ccc(-c2ccc(F)cc2F)o1 |
|---|
Synonyms
| 3-[5-(2,4-difluorophenyl)-2-furyl]acrylic acid |
| 2-Propenoic acid,3-[5-(2,4-difluorophenyl)-2-furanyl] |
