Introduction：Basic information about CAS 1138-58-5|4-butoxybenzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-butoxybenzenesulfonamide |
|---|
| CAS Number | 1138-58-5 | Molecular Weight | 229.29600 |
|---|
| Density | 1.194g/cm3 | Boiling Point | 381.9ºC at 760 mmHg |
|---|
| Molecular Formula | C10H15NO3S | Melting Point | 102-104ºC |
|---|
| MSDS | / | Flash Point | 184.8ºC |
|---|
Names
| Name | 4-butoxybenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.194g/cm3 |
|---|
| Boiling Point | 381.9ºC at 760 mmHg |
|---|
| Melting Point | 102-104ºC |
|---|
| Molecular Formula | C10H15NO3S |
|---|
| Molecular Weight | 229.29600 |
|---|
| Flash Point | 184.8ºC |
|---|
| Exact Mass | 229.07700 |
|---|
| PSA | 77.77000 |
|---|
| LogP | 3.29400 |
|---|
| Vapour Pressure | 4.92E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.531 |
|---|
| InChIKey | GJCVWKPGGOMFQR-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOc1ccc(S(N)(=O)=O)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| (4-n-butoxybenzene)sulfonamide |
| 4-butoxy-benzenesulfonic acid amide |
| 4-(n-butoxy)benzenesulphonamide |
| benzenesulfonamide,4-butoxy |
| F1084-0540 |
| 4-Butoxy-benzolsulfonsaeure-amid |
| MFCD00833414 |
| 4-butoxybenzene-1-sulfonamide |
