Introduction：Basic information about CAS 54001-18-2|4-Methyl-2-phenylthiazole-5-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Methyl-2-phenylthiazole-5-carbonyl chloride |
|---|
| CAS Number | 54001-18-2 | Molecular Weight | 237.70500 |
|---|
| Density | 1.319g/cm3 | Boiling Point | 371.8ºC at 760mmHg |
|---|
| Molecular Formula | C11H8ClNOS | Melting Point | 122ºC |
|---|
| MSDS | USA | Flash Point | 178.6ºC |
|---|
Names
| Name | 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.319g/cm3 |
|---|
| Boiling Point | 371.8ºC at 760mmHg |
|---|
| Melting Point | 122ºC |
|---|
| Molecular Formula | C11H8ClNOS |
|---|
| Molecular Weight | 237.70500 |
|---|
| Flash Point | 178.6ºC |
|---|
| Exact Mass | 237.00200 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 3.49750 |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | ZQWZVEKZFVCSNY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)Cl |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 3261 |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| MFCD02677709 |
| TD8059 |
| 4-Methyl-2-phenyl-thiazole-5-carbonyl chloride |
| 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl-chloride |
