Introduction：Basic information about CAS 112143-82-5|Triazamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Triazamate |
|---|
| CAS Number | 112143-82-5 | Molecular Weight | 314.40400 |
|---|
| Density | 1.2357 (rough estimate) | Boiling Point | 280°C (rough estimate) |
|---|
| Molecular Formula | C13H22N4O3S | Melting Point | 60° |
|---|
| MSDS | USA | Flash Point | 189℃ |
|---|
| Symbol |
GHS06, GHS09 | Signal Word | Danger |
|---|
Names
| Name | triazamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2357 (rough estimate) |
|---|
| Boiling Point | 280°C (rough estimate) |
|---|
| Melting Point | 60° |
|---|
| Molecular Formula | C13H22N4O3S |
|---|
| Molecular Weight | 314.40400 |
|---|
| Flash Point | 189℃ |
|---|
| Exact Mass | 314.14100 |
|---|
| PSA | 102.62000 |
|---|
| LogP | 1.76050 |
|---|
| Index of Refraction | 1.6200 (estimate) |
|---|
| InChIKey | NKNFWVNSBIXGLL-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CSc1nc(C(C)(C)C)nn1C(=O)N(C)C |
|---|
Safety Information
| Symbol |
GHS06, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H319-H330-H400 |
|---|
| Precautionary Statements | P260-P273-P284-P301 + P310-P305 + P351 + P338-P310 |
|---|
| Hazard Codes | T,N |
|---|
| Risk Phrases | R10;R23/24/25;R36;R50/53 |
|---|
| Safety Phrases | S36/37-S45-S60-S61 |
|---|
| RIDADR | UN2811 - class 6.1 - PG 2 - EHS - Toxic solids, organic, n.o.s., HI: all |
|---|
Synonyms
| ethyl 2-[[1-[(dimethylamino)carbonyl]-3-(1,1-dimethylethyl)-1H-1,2,4-triazol-5-yl]thio]acetate |
| ethyl {[3-tert-butyl-1-(dimethylcarbamoyl)-1H-1,2,4-triazol-5-yl]sulfanyl}acetate |
| ethyl (3-tert-butyl-1-dimethylcarbamoyl-1H-1,2,4-triazol-5-ylthio)acetate |
| Triazuron |
| TRIAZAMATE |
| APHISTAR |
