Introduction:Basic information about CAS 14172-90-8|5,10,15,20-Tetraphenyl-21H,23H-porphine cobalt(II), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,10,15,20-Tetraphenyl-21H,23H-porphine cobalt(II) |
|---|
| CAS Number | 14172-90-8 | Molecular Weight | 671.65300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C44H28CoN4 | Melting Point | >300ºC (dec.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | cobalt(2+),5,10,15,20-tetraphenyl-1,4,5,10,11,14,15,20,21,23-decahydroporphyrin-22,24-diide |
|---|
| Synonym | More Synonyms |
|---|
BiologicalActivity
| Description | 5,10,15,20-Tetraphenyl-21H,23H-porphine cobalt(II) is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|
| Related Catalog | Research Areas >>Others |
|---|
Chemical & Physical Properties
| Melting Point | >300ºC (dec.) |
|---|
| Molecular Formula | C44H28CoN4 |
|---|
| Molecular Weight | 671.65300 |
|---|
| Exact Mass | 671.16500 |
|---|
| PSA | 34.58000 |
|---|
| LogP | 6.43780 |
|---|
| InChIKey | LSZLYWSRWXFMOI-UHFFFAOYSA-N |
|---|
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([n-]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c2-c2ccccc2)C=C1.[Co+2] |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| cobalt(II)-tetraphenylporphyrine |
| EINECS 238-018-8 |
| cobalt(III) chloride |
| Cobalt chloride (CoCl3) |
| (Tetraphenylporphinato)cobalt |
| Cobalt trichloride |
| Cobalt(II) meso-Tetraphenylporphine |
| Cobalt(II) Tetraphenylporphyrin |
| Cobaltic chloride |
| cobalt(II) 5,10,15,20-tetraphenylporphyrin |
| Kobalt(III)-chlorid |
| MFCD00010725 |
| 5,10,15,20-tetraphenyl-21H,23H-porphine Co(II) |
| cobalt-meso-tetraphenylporphyrin |
| CoII(tetraphenylporphyrin) |
| Co(II)-meso-tetraphenylporphyrin |
| 5,10,15,20-Tetraphenyl-21H,23H-porphine Cobalt(II) |