Introduction：Basic information about CAS 59748-17-3|4-(4-heptoxyphenyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-heptoxyphenyl)benzoic acid |
|---|
| CAS Number | 59748-17-3 | Molecular Weight | 312.40300 |
|---|
| Density | 1.076 g/cm3 | Boiling Point | 471.9ºC at 760 mmHg |
|---|
| Molecular Formula | C20H24O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 164.2ºC |
|---|
Names
| Name | 4-(4-heptoxyphenyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.076 g/cm3 |
|---|
| Boiling Point | 471.9ºC at 760 mmHg |
|---|
| Molecular Formula | C20H24O3 |
|---|
| Molecular Weight | 312.40300 |
|---|
| Flash Point | 164.2ºC |
|---|
| Exact Mass | 312.17300 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 5.40100 |
|---|
| InChIKey | BDDYPNQQJHNKSC-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCOc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-(4'-n-heptyloxyphenyl)benzoic acid |
| 4'-Heptyloxy-biphenyl-4-carbonsaeure |
| 4-(4-heptyloxyphenyl)benzoic acid |
| 4'-heptyloxy-4-biphenylcarboxylic acid |
| 4''-(n-Heptyloxy)biphenyl-4'-carbonsaeure |
| 4-n-heptyloxybiphenyl-4'-carboxylic acid |
| 4'-heptyloxy-biphenyl-4-carboxylic acid |
