Introduction：Basic information about CAS 21406-61-1|Pentyltriphenylphosphonium bromide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pentyltriphenylphosphonium bromide |
|---|
| CAS Number | 21406-61-1 | Molecular Weight | 413.330 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C23H26BrP | Melting Point | 165-168 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | pentyl(triphenyl)phosphanium,bromide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 165-168 °C |
|---|
| Molecular Formula | C23H26BrP |
|---|
| Molecular Weight | 413.330 |
|---|
| Exact Mass | 412.095551 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 2.17470 |
|---|
| InChIKey | VAUKWMSXUKODHR-UHFFFAOYSA-M |
|---|
| SMILES | CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
|---|
Safety Information
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S37/39-S26 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| CH3(CH2)4PPh3Br |
| MFCD00031630 |
| Pentyl(triphenyl)phosphonium bromide |
| Phosphonium, pentyltriphenyl-, bromide (1:1) |
| Amyltriphenylphosphonium bromide |
| EINECS 244-374-5 |
| n-pentyltriphenylphosphonium bromide |
| pentyl-PPh3 bromide |
| pentyl(triphenyl)phosphanium bromide |
| Ph3P(CH2)4CH3Br |
| Pentyltriphenylphosphonium Bromide |
| Ph3P(n-C5H11)Br |
