Introduction：Basic information about CAS 5197-87-5|Benzyltripropylammonium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzyltripropylammonium chloride |
|---|
| CAS Number | 5197-87-5 | Molecular Weight | 269.85300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C16H28ClN | Melting Point | ~180 °C (dec.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | benzyl(tripropyl)azanium,chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | ~180 °C (dec.) |
|---|
| Molecular Formula | C16H28ClN |
|---|
| Molecular Weight | 269.85300 |
|---|
| Exact Mass | 269.19100 |
|---|
| LogP | 1.23740 |
|---|
| InChIKey | YTRIOKYQEVFKGU-UHFFFAOYSA-M |
|---|
| SMILES | CCC[N+](CCC)(CCC)Cc1ccccc1.[Cl-] |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2923900090 |
|---|
Customs
| HS Code | 2923900090 |
|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| benzyltri-n-propylammonium chloride |
| MFCD00051869 |
| Tripropyl-benzyl-ammonium |
| N-Benzyl-N,N-dipropylpropan-1-aminium chloride |
| PhCH2NPr3Cl |
| Benzyltripropylammonium chloride |
| tripropylbenzylammonium chloride |
| benzyl(tripropyl)azanium chloride |
