CAS 2641-89-6|2,3,5,6-Tetrabromo-1,4-benzenediol
Introduction：Basic information about CAS 2641-89-6|2,3,5,6-Tetrabromo-1,4-benzenediol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,5,6-Tetrabromo-1,4-benzenediol | ||
|---|---|---|---|
| CAS Number | 2641-89-6 | Molecular Weight | 425.695 |
| Density | 2.8±0.1 g/cm3 | Boiling Point | 304.4±37.0 °C at 760 mmHg |
| Molecular Formula | C6H2Br4O2 | Melting Point | 252-255 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 137.9±26.5 °C |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | tetrabromohydroquinone |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 2.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 304.4±37.0 °C at 760 mmHg |
| Melting Point | 252-255 °C(lit.) |
| Molecular Formula | C6H2Br4O2 |
| Molecular Weight | 425.695 |
| Flash Point | 137.9±26.5 °C |
| Exact Mass | 421.678802 |
| PSA | 40.46000 |
| LogP | 5.80 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.738 |
| InChIKey | DTFQULSULHRJOA-UHFFFAOYSA-N |
| SMILES | Oc1c(Br)c(Br)c(O)c(Br)c1Br |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
Articles4
More Articles| Thermoresponsive dendrimers based on oligoethylene glycols: design, synthesis and cytotoxic activity against MCF-7 breast cancer cells. Eur. J. Med. Chem. 69 , 848-54, (2013) Three interesting thermoresponsive branched oligoethylene glycol dendrimers based on tetrabromohydroquinone were efficiently synthesized from tetrabromohydroquinone and three different oligoethylene g... | |
| Tetrabromohydroquinone and riboflavin are possibly responsible for green luminescence in the luminous acorn worm, Ptychodera flava. Luminescence 20(6) , 397-400, (2005) 2,3,5,6-Tetrabromohydroquinone was isolated as a luminous substance from Ptychodera flava. This compound emitted light after addition of hydrogen peroxide under basic conditions. Since hydroquinone ha... | |
| Reaction of phenylphosphine with p-quinones. Pudovik AN, et al. Russ. Chem. Bull. 27(7) , 1450-1452, (1978) |
Synonyms
| tetra-bromo-1,4-hydroquinone |
| Tetrabromo-p-hydroquinone |
| 1,2,4,5-Tetrabromo-3,6-dihydroxybenzene |
| 2,3,5,6-tetrabromobenzene-1,4-diol |
| 1,4-Benzenediol, 2,3,5,6-tetrabromo- |
| 2,3,5,6-Tetrabromo-1,4-benzenediol |
| MFCD00013970 |
| tetrabromo-hydroquinone |
| 2,3,5,6-tetrabromo-1,4-hydroquinone |
| 1,2,4,5-Tetrabromo-3,6-dihydroxybenzeneTetrabromoquinol |
| EINECS 220-142-9 |
| Tetrabromoquinol |
| 2,3,5,6-Tetrabromohydroquinone |
| Tetrabromohydroquinone |
