Introduction：Basic information about CAS 19230-50-3|2-IODO-5-NITROBENZOIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-IODO-5-NITROBENZOIC ACID |
|---|
| CAS Number | 19230-50-3 | Molecular Weight | 293.01500 |
|---|
| Density | 2.156g/cm3 | Boiling Point | 394.2ºC at 760 mmHg |
|---|
| Molecular Formula | C7H4INO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.2ºC |
|---|
Names
| Name | 2-iodo-5-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.156g/cm3 |
|---|
| Boiling Point | 394.2ºC at 760 mmHg |
|---|
| Molecular Formula | C7H4INO4 |
|---|
| Molecular Weight | 293.01500 |
|---|
| Flash Point | 192.2ºC |
|---|
| Exact Mass | 292.91900 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 2.42080 |
|---|
| Vapour Pressure | 6.36E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.702 |
|---|
| InChIKey | JSSFIFUXHORXJX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1I |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-iodoyl-5-nitrobenzoic acid |
| 2-Jod-5-nitro-benzoesaeure |
| 2-iodo-5-nitro benzoic acid |
| 5-nitro-2-iodobenzoic acid |
| Benzoic acid,2-iodo-5-nitro |
| 2-Iod-5-nitrobenzoesaeure |
