Introduction：Basic information about CAS 7575-82-8|Tricyclo[3.3.1.13,7]decane,1-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tricyclo[3.3.1.13,7]decane,1-nitro- |
|---|
| CAS Number | 7575-82-8 | Molecular Weight | 181.23200 |
|---|
| Density | 1.19g/cm3 | Boiling Point | 277.1ºC at 760mmHg |
|---|
| Molecular Formula | C10H15NO2 | Melting Point | 159ºC |
|---|
| MSDS | / | Flash Point | 121.8ºC |
|---|
Names
| Name | 1-nitroadamantane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.19g/cm3 |
|---|
| Boiling Point | 277.1ºC at 760mmHg |
|---|
| Melting Point | 159ºC |
|---|
| Molecular Formula | C10H15NO2 |
|---|
| Molecular Weight | 181.23200 |
|---|
| Flash Point | 121.8ºC |
|---|
| Exact Mass | 181.11000 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 2.75510 |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | HONLSNLUVRQMEK-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])C12CC3CC(CC(C3)C1)C2 |
|---|
Synonyms
| Adamantane,1-nitro |
| Nitro Adamantane |
| 1-Nitro-adamantane |
