Introduction：Basic information about CAS 401916-48-1|Boc-(R)-3-AMino-4-(4-tert-butyl-phenyl)-butyric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-(R)-3-AMino-4-(4-tert-butyl-phenyl)-butyric acid |
|---|
| CAS Number | 401916-48-1 | Molecular Weight | 335.438 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 479.0±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H29NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 243.5±27.3 °C |
|---|
Names
| Name | (2R)-3-amino-4-(4-tert-butylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 479.0±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H29NO4 |
|---|
| Molecular Weight | 335.438 |
|---|
| Flash Point | 243.5±27.3 °C |
|---|
| Exact Mass | 335.209656 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 4.87 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.511 |
|---|
| InChIKey | VJXYUVJDZAIFHC-OAHLLOKOSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccc(C(C)(C)C)cc1 |
|---|
Synonyms
| Benzenebutanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-4-(1,1-dimethylethyl)-, (βS)- |
| (3S)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-[4-(2-methyl-2-propanyl)phenyl]butanoic acid |
| Benzenebutanoicacid,b-[[(1,1-dimethylethoxy)carbonyl]amino]-4-(1,1-dimethylethyl)-,(bR) |
| Boc-(R)-3-AMino-4-(4-tert-butyl-phenyl)-butyric acid |
