Introduction：Basic information about CAS 5728-46-1|4'-Cyano-4-biphenylcarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-Cyano-4-biphenylcarboxylic acid |
|---|
| CAS Number | 5728-46-1 | Molecular Weight | 223.227 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 443.0±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H9NO2 | Melting Point | 263-266ºC |
|---|
| MSDS | / | Flash Point | 221.7±26.8 °C |
|---|
Names
| Name | 4-(4-cyanophenyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 443.0±38.0 °C at 760 mmHg |
|---|
| Melting Point | 263-266ºC |
|---|
| Molecular Formula | C14H9NO2 |
|---|
| Molecular Weight | 223.227 |
|---|
| Flash Point | 221.7±26.8 °C |
|---|
| Exact Mass | 223.063324 |
|---|
| PSA | 61.09000 |
|---|
| LogP | 3.07 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.650 |
|---|
| InChIKey | KBNUZLPQQMVGPR-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| MFCD00438676 |
| cyanobiphenylcarboxylicacid |
| 4'-Cyano-biphenyl-4-carboxylic acid |
| [1,1'-Biphenyl]-4-carboxylic acid, 4'-cyano- |
| 4'-Cyano-4-biphenyl carboxylic acid |
| 4'-Cyano-4-biphenylcarboxylic acid |
| 4'-Cyanobiphenyl-4-carboxylic acid |
