Introduction:Basic information about CAS 435341-96-1|4-(diethylaminomethyl)-2-methyl-5-(2-methylpropyl)furan-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(diethylaminomethyl)-2-methyl-5-(2-methylpropyl)furan-3-carboxylic acid |
|---|
| CAS Number | 435341-96-1 | Molecular Weight | 267.36400 |
|---|
| Density | 1.04g/cm3 | Boiling Point | 341ºC at 760mmHg |
|---|
| Molecular Formula | C15H25NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160ºC |
|---|
Names
| Name | 4-(diethylaminomethyl)-2-methyl-5-(2-methylpropyl)furan-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.04g/cm3 |
|---|
| Boiling Point | 341ºC at 760mmHg |
|---|
| Molecular Formula | C15H25NO3 |
|---|
| Molecular Weight | 267.36400 |
|---|
| Flash Point | 160ºC |
|---|
| Exact Mass | 267.18300 |
|---|
| PSA | 53.68000 |
|---|
| LogP | 3.32650 |
|---|
| Index of Refraction | 1.505 |
|---|
| InChIKey | HFZOCCWWXYPZDV-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)Cc1c(CC(C)C)oc(C)c1C(=O)O |
|---|
Synonyms
| 4-Diethylaminomethyl-5-isobutyl-2-methyl-furan-3-carboxylic acid |
| HMS1554L04 |