Introduction:Basic information about CAS 144104-44-9|5-(4-FLUORO-PHENYL)-1H-INDOLE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(4-FLUORO-PHENYL)-1H-INDOLE |
|---|
| CAS Number | 144104-44-9 | Molecular Weight | 211.23400 |
|---|
| Density | 1.232g/cm3 | Boiling Point | 389.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10FN | Melting Point | / |
|---|
| MSDS | / | Flash Point | 189.1ºC |
|---|
Names
| Name | 5-(4-fluorophenyl)-1H-indole |
|---|
Chemical & Physical Properties
| Density | 1.232g/cm3 |
|---|
| Boiling Point | 389.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10FN |
|---|
| Molecular Weight | 211.23400 |
|---|
| Flash Point | 189.1ºC |
|---|
| Exact Mass | 211.08000 |
|---|
| PSA | 15.79000 |
|---|
| LogP | 3.97400 |
|---|
| Vapour Pressure | 6.55E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | FZEPXXHITBIOIY-UHFFFAOYSA-N |
|---|
| SMILES | Fc1ccc(-c2ccc3[nH]ccc3c2)cc1 |
|---|