Introduction:Basic information about CAS 15854-75-8|2-PHENYL-4-NITRO-ANISOLE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-PHENYL-4-NITRO-ANISOLE |
|---|
| CAS Number | 15854-75-8 | Molecular Weight | 229.23100 |
|---|
| Density | 1.202g/cm3 | Boiling Point | 355.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 156.1ºC |
|---|
Names
| Name | 1-methoxy-4-nitro-2-phenylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.202g/cm3 |
|---|
| Boiling Point | 355.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11NO3 |
|---|
| Molecular Weight | 229.23100 |
|---|
| Flash Point | 156.1ºC |
|---|
| Exact Mass | 229.07400 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 3.79360 |
|---|
| Vapour Pressure | 6.31E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | DFVBQSMLKLCRCB-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc([N+](=O)[O-])cc1-c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| methyl-(5-nitro-biphenyl-2-yl)-ether |
| 2-Methoxy-5-nitro-biphenyl |
| 2-Methoxy-5-nitro-1,1'-biphenyl |
| 2-phenyl-4-nitroanisole |
| Methyl-(5-nitro-biphenyl-2-yl)-aether |
| CTK4C9730 |
| AC1O50M3 |
| 5-Nitro-2-methoxy-1-phenyl-benzol |
| 2-phenyl-4-nitroanisol |
| 5-Nitro-2-methoxy-diphenyl |