Introduction：Basic information about CAS 851392-68-2|Fmoc-Dab(Mtt)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-Dab(Mtt)-OH |
|---|
| CAS Number | 851392-68-2 | Molecular Weight | 596.714 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 788.4±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C39H36N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 430.6±32.9 °C |
|---|
Names
| Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[[(4-methylphenyl)-diphenylmethyl]amino]butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 788.4±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C39H36N2O4 |
|---|
| Molecular Weight | 596.714 |
|---|
| Flash Point | 430.6±32.9 °C |
|---|
| Exact Mass | 596.267517 |
|---|
| PSA | 87.66000 |
|---|
| LogP | 9.78 |
|---|
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | RXKBBKLPMHPIKD-BHVANESWSA-N |
|---|
| SMILES | Cc1ccc(C(NCCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)(c2ccccc2)c2ccccc2)cc1 |
|---|
Synonyms
| 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[[(4-methylphenyl)-diphenyl-methyl]amino]butanoic acid |
| (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-{[(4-methylphenyl)(diphenyl)methyl]amino}butanoic acid |
| 2-[[9H-fluoren-9-ylmethoxy(oxo)methyl]amino]-4-[[(4-methylphenyl)-diphenylmethyl]amino]butanoic acid |
| Butanoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-4-[[(4-methylphenyl)diphenylmethyl]amino]-, (2S)- |
| Fmoc-Dab(Mtt)-OH |
