Introduction：Basic information about CAS 423719-54-4|Fmoc-Thz-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-Thz-OH |
|---|
| CAS Number | 423719-54-4 | Molecular Weight | 367.41800 |
|---|
| Density | 1.402g/cm3 | Boiling Point | 591.614ºC at 760 mmHg |
|---|
| Molecular Formula | C20H17NO4S | Melting Point | 153-158ºC |
|---|
| MSDS | / | Flash Point | 311.597ºC |
|---|
Names
| Name | fmoc-thz-oh |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.402g/cm3 |
|---|
| Boiling Point | 591.614ºC at 760 mmHg |
|---|
| Melting Point | 153-158ºC |
|---|
| Molecular Formula | C20H17NO4S |
|---|
| Molecular Weight | 367.41800 |
|---|
| Flash Point | 311.597ºC |
|---|
| Exact Mass | 367.08800 |
|---|
| PSA | 98.93000 |
|---|
| LogP | 3.40220 |
|---|
| Index of Refraction | 1.668 |
|---|
| InChIKey | HUWNZLPLVVGCMO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1CSCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
|---|
Safety Information
| Hazard Codes | Xn,Xi |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | 26-36 |
|---|
Synonyms
| fmoc-l-thiaproline |
| fmoc-l-thioproline |
| fmoc-(r)-thiazolidine-4-carboxylic acid |
| fmoc-l-thz-oh |
| fmoc-l-thiopro-oh |
| fmoc-l-thiazolidine-4-carboxylic acid |
| rarechem ar pa 0002 |
| fmoc-thiopro-oh |
