Introduction：Basic information about CAS 155773-67-4|Copper(II) 5,9,14,18,23,27,32,36-Octabutoxy-2,3-naphthalocyanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Copper(II) 5,9,14,18,23,27,32,36-Octabutoxy-2,3-naphthalocyanine |
|---|
| CAS Number | 155773-67-4 | Molecular Weight | 1353.15000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C80H88CuN8O8 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | Cu(5,9,14,18,23,27,32,36-octabutoxynaphthalocyanine(2-)) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C80H88CuN8O8 |
|---|
| Molecular Weight | 1353.15000 |
|---|
| Exact Mass | 1351.60000 |
|---|
| PSA | 157.86000 |
|---|
| LogP | 15.50590 |
|---|
| InChIKey | JJIWQZDKAOMTKU-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOc1c2c(c(OCCCC)c3ccccc13)-c1nc-2nc2[n-]c(nc3nc(nc4[n-]c(n1)c1c(OCCCC)c5ccccc5c(OCCCC)c41)-c1c-3c(OCCCC)c3ccccc3c1OCCCC)c1c(OCCCC)c3ccccc3c(OCCCC)c21.[Cu+2] |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Cu(4,4'-bipyridine)(H2O)2(tetrafluoroborate)2(4,4'-bipyridine) |
| Precursor-ELM-11 |
| Cu(4-aminosalicylic acid)2 |
| pre-ELM-11 |
| [Cu(bpy)(BF4)2(H2O)2]bpy |
| MFCD00191950 |
| 5,9,14,18,23,27,32,36-Octabutoxy-2,3-naphthalocyanine Copper(II) |
