Introduction:Basic information about CAS 21134-15-6|1-Methanesulfonyl-4-phenoxy-benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Methanesulfonyl-4-phenoxy-benzene |
|---|
| CAS Number | 21134-15-6 | Molecular Weight | 248.29800 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 407.6ºC at 760mmHg |
|---|
| Molecular Formula | C13H12O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 200.3ºC |
|---|
Names
| Name | 1-methylsulfonyl-4-phenoxybenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 407.6ºC at 760mmHg |
|---|
| Molecular Formula | C13H12O3S |
|---|
| Molecular Weight | 248.29800 |
|---|
| Flash Point | 200.3ºC |
|---|
| Exact Mass | 248.05100 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 3.96320 |
|---|
| Vapour Pressure | 1.75E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | XVEKOLSQMFRDKJ-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-Methylsulfonyl-diphenylaether |
| 1-methanesulfonyl-4-phenoxy-benzene |
| Benzene,1-(methylsulfonyl)-4-phenoxy |
| 4-Methylsulfon-diphenylether |
| 4-phenoxyphenyl methyl sulfone |
| 1-(4-(methylsulfonyl)phenoxy]benzene |
| p-Phenoxyphenylmethylsulfon |
| GL-1065 |
| 4-methylsulfonyl-diphenyl ether |