Introduction：Basic information about CAS 870075-87-9|Propanedinitrile,[2-(2-propyl)-6-[2-(2,3,6,7-tetrahydro-2,2,7,7-tetramethyl-1H,5H-be, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Propanedinitrile,[2-(2-propyl)-6-[2-(2,3,6,7-tetrahydro-2,2,7,7-tetramethyl-1H,5H-benzo[ij]quinolizin-9-yl)ethenyl]-4H-pyran |
|---|
| CAS Number | 870075-87-9 | Molecular Weight | 439.592 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 555.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C29H33N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 289.5±30.1 °C |
|---|
Names
| Name | 2-[2-(1-Methylethyl)-6-[2-(2,3,6,7-tetrahydro-1,1,7,7-tetramethyl-1H,5H-benzo[ij]quinolizin-9-yl)ethenyl]-4H-pyran-4-ylidene]propanedinitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 555.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C29H33N3O |
|---|
| Molecular Weight | 439.592 |
|---|
| Flash Point | 289.5±30.1 °C |
|---|
| Exact Mass | 439.262360 |
|---|
| PSA | 60.05000 |
|---|
| LogP | 5.57 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | UOOBIWAELCOCHK-BQYQJAHWSA-N |
|---|
| SMILES | CC(C)C1=CC(=C(C#N)C#N)C=C(C=Cc2cc3c4c(c2)C(C)(C)CCN4CCC3(C)C)O1 |
|---|
Synonyms
| {2-Isopropyl-6-[(E)-2-(1,1,7,7-tetramethyl-2,3,6,7-tetrahydro-1H,5H-pyrido[3,2,1-ij]quinolin-9-yl)vinyl]-4H-pyran-4-ylidene}malononitrile |
| Propanedinitrile,[2 |
| DCJTI,Tris(1,3-diphenyl-1,3-propanedionato)(1,10-phenanthr |
| Propanedinitrile,[2-(2-propyl)-6-[2-(2,3,6,7-tetrahydro-2,2,7,7-tetramethyl-1H,5H-benzo [ij]quinolizin-9-yl)ethenyl]-4H-pyran |
| Propanedinitrile, 2-[2-(1-methylethyl)-6-[(E)-2-(2,3,6,7-tetrahydro-1,1,7,7-tetramethyl-1H,5H-benzo[ij]quinolizin-9-yl)ethenyl]-4H-pyran-4-ylidene]- |
