Introduction：Basic information about CAS 14548-48-2|4-(4-chlorobenzoyl)pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-chlorobenzoyl)pyridine |
|---|
| CAS Number | 14548-48-2 | Molecular Weight | 217.65100 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 357.3ºC at 760mmHg |
|---|
| Molecular Formula | C12H8ClNO | Melting Point | 108-110 °C(lit.) |
|---|
| MSDS | / | Flash Point | 169.9ºC |
|---|
Names
| Name | (4-chlorophenyl)-pyridin-4-ylmethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 357.3ºC at 760mmHg |
|---|
| Melting Point | 108-110 °C(lit.) |
|---|
| Molecular Formula | C12H8ClNO |
|---|
| Molecular Weight | 217.65100 |
|---|
| Flash Point | 169.9ºC |
|---|
| Exact Mass | 217.02900 |
|---|
| PSA | 29.96000 |
|---|
| LogP | 2.96600 |
|---|
| Vapour Pressure | 2.75E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | YMTFKKLFLLAFNI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccncc1)c1ccc(Cl)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| EINECS 238-587-2 |
| MFCD00006431 |
| (4-Chlor-phenyl)-[4]pyridyl-keton |
| (4-chlorophenyl)(pyridin-4-yl)methanone |
| 4-chlorophenyl 4-pyridyl ketone |
| 4-(4-Chlorobenzoyl)pyridine |
