Introduction：Basic information about CAS 67763-24-0|bromocresol green sodium salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bromocresol green sodium salt |
|---|
| CAS Number | 67763-24-0 | Molecular Weight | 738.01100 |
|---|
| Density | 0.981 | Boiling Point | 100ºC |
|---|
| Molecular Formula | C21H15Br4NaO6S | Melting Point | 225ºC |
|---|
| MSDS | Chinese | Flash Point | / |
|---|
Names
| Name | Bromocresol Green, sodium salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.981 |
|---|
| Boiling Point | 100ºC |
|---|
| Melting Point | 225ºC |
|---|
| Molecular Formula | C21H15Br4NaO6S |
|---|
| Molecular Weight | 738.01100 |
|---|
| Exact Mass | 733.72200 |
|---|
| PSA | 126.27000 |
|---|
| LogP | 7.03370 |
|---|
| Appearance of Characters | Powder | Very dark brown to greenish-black |
|---|
| InChIKey | HEFSGAHJDGZCHA-UHFFFAOYSA-M |
|---|
| SMILES | Cc1c(C2(c3cc(Br)c(O)c(Br)c3C)OS(=O)(=O)c3ccccc32)cc(Br)c([O-])c1Br.[Na+] |
|---|
Safety Information
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S24/25 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| bromocresol green sodium salt |
| EINECS 263-657-4 |
