Introduction：Basic information about CAS 860236-13-1|4-BOC-2-CYANOPIPERIDINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-BOC-2-CYANOPIPERIDINE |
|---|
| CAS Number | 860236-13-1 | Molecular Weight | 305.50000 |
|---|
| Density | 2.047g/cm3 | Boiling Point | 352.9ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5ClINO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167.2ºC |
|---|
Names
| Name | 7-chloro-3-iodo-1H-quinolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.047g/cm3 |
|---|
| Boiling Point | 352.9ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5ClINO |
|---|
| Molecular Weight | 305.50000 |
|---|
| Flash Point | 167.2ºC |
|---|
| Exact Mass | 304.91000 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 3.19840 |
|---|
| Index of Refraction | 1.767 |
|---|
| InChIKey | POLASDJYPIWKKS-UHFFFAOYSA-N |
|---|
| SMILES | O=c1c(I)c[nH]c2cc(Cl)ccc12 |
|---|
Synonyms
| 4-Hydroxy-7-chloro-3-iodoquinoline |
| 7-Chlor-3-jod-chinolin-4-ol |
| 7-chloro-3-iodo-quinolin-4-ol |
| 4-Quinolinol,7-chloro-3-iodo |
