Introduction：Basic information about CAS 5342-23-4|6-Methoxy-4-methyl-2-quinolinol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Methoxy-4-methyl-2-quinolinol |
|---|
| CAS Number | 5342-23-4 | Molecular Weight | 189.210 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 397.8±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H11NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 194.4±26.5 °C |
|---|
Names
| Name | 6-methoxy-4-methyl-1H-quinolin-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 397.8±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H11NO2 |
|---|
| Molecular Weight | 189.210 |
|---|
| Flash Point | 194.4±26.5 °C |
|---|
| Exact Mass | 189.078979 |
|---|
| PSA | 42.35000 |
|---|
| LogP | 2.50 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | VGQWDNJRHAWUNX-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2[nH]c(=O)cc(C)c2c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933499090 |
|---|
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-methoxy-4-methylquinolin-2-ol |
| 2-hydroxy-4-methyl-6-methoxyquinoline |
| 6-Methoxy-4-methyl-2-quinolinol |
| 6-Methoxy-2-hydroxylepidin |
| 6-Methoxy-4-methyl-chinolin-2-ol |
| 6-Methoxy-4-methylcarbostyril |
| 2-quinolinol, 6-methoxy-4-methyl- |
| 2-Methyl-6-methoxychinolin-4-ol |
| 2-Hydroxy-6-methoxy-4-methyl-chinolin |
| 2-Hydroxy-6-methoxy-4-methylquinoline |
